CAS 338422-73-4 appears in our catalog under these names: 2-((3-Chloro-5-(trifluoromethyl)pyridin-2-yl)thio)acetic acid, 97%, 2-(3-chloro-5-(trifluoromethyl)-2-pyridylthio)acetic acid, 2-{[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-sulfanyl}acetic acid, 95%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid (CAS 338422-73-4) is a chemical compound with the molecular formula C8H5ClF3NO2S and a molecular weight of 271.64 g/mol. IUPAC name: 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid. InChIKey: IAMIKJTZALCGDG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2S |
|---|---|
| Molecular weight | 271.64 g/mol |
| IUPAC name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid |
| InChIKey | IAMIKJTZALCGDG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)SCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)