CAS 642461-04-9 is the registry number for N-(Benzenesulfonyl)-2,2,2-trifluoroethanecarbonimidoyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1000mg.
N-(benzenesulfonyl)-2,2,2-trifluoroethanimidoyl chloride (CAS 642461-04-9) is a chemical compound with the molecular formula C8H5ClF3NO2S and a molecular weight of 271.64 g/mol. IUPAC name: N-(benzenesulfonyl)-2,2,2-trifluoroethanimidoyl chloride. InChIKey: OHGCUODTFLYDEK-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2S |
|---|---|
| Molecular weight | 271.64 g/mol |
| IUPAC name | N-(benzenesulfonyl)-2,2,2-trifluoroethanimidoyl chloride |
| InChIKey | OHGCUODTFLYDEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N=C(C(F)(F)F)Cl |
Computed by PubChem (NCBI)