Products 338739-97-2
CAS 338739-97-2 is the registry number for 2-(Trifluoromethyl)Pyrido[2,3-D]Pyrimidin-4(3H)-One, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 338739-97-2) is a chemical compound with the molecular formula C8H4F3N3O and a molecular weight of 215.13 g/mol. IUPAC name: 2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: RNYZPQSAGWZVGM-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N3O |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | RNYZPQSAGWZVGM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(NC2=O)C(F)(F)F |
Computed by PubChem (NCBI)