CAS 338749-12-5 appears in our catalog under these names: 3,3-Dimethyl-2-(1-oxo-2,3-dihydro-1H-isoindol-2-yl)butanoic acid, 95%, 3,3-Dimethyl-2-(1-oxo-2,3-dihydro-1H-isoindol-2-yl)butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,3-dimethyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid (CAS 338749-12-5) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: 3,3-dimethyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid. InChIKey: MXATWGSJZOCHSJ-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 3,3-dimethyl-2-(3-oxo-1H-isoindol-2-yl)butanoic acid |
| InChIKey | MXATWGSJZOCHSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)N1CC2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)