CAS 338753-84-7 is the registry number for N'-(6-Fluoro-2-pyridinyl)benzenecarbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N'-(6-fluoro-2-pyridinyl)benzohydrazide (CAS 338753-84-7) is a chemical compound with the molecular formula C12H10FN3O and a molecular weight of 231.23 g/mol. IUPAC name: N'-(6-fluoro-2-pyridinyl)benzohydrazide. InChIKey: BAUPQBFGJHQCGW-UHFFFAOYSA-N.
| Molecular formula | C12H10FN3O |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | N'-(6-fluoro-2-pyridinyl)benzohydrazide |
| InChIKey | BAUPQBFGJHQCGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NNC2=NC(=CC=C2)F |
Computed by PubChem (NCBI)