CAS 917758-83-9 is the registry number for 3–amino–6–(4–fluorophenyl)picolinamide. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
3-amino-6-(4-fluorophenyl)pyridine-2-carboxamide (CAS 917758-83-9) is a chemical compound with the molecular formula C12H10FN3O and a molecular weight of 231.23 g/mol. IUPAC name: 3-amino-6-(4-fluorophenyl)pyridine-2-carboxamide. InChIKey: LDNDSZHNXOYKDR-UHFFFAOYSA-N.
| Molecular formula | C12H10FN3O |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 3-amino-6-(4-fluorophenyl)pyridine-2-carboxamide |
| InChIKey | LDNDSZHNXOYKDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=C(C=C2)N)C(=O)N)F |
Computed by PubChem (NCBI)