CAS 33876-94-7 is the registry number for Clonidine Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
N-phenylimidazole-1-carboxamide (CAS 33876-94-7) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: N-phenylimidazole-1-carboxamide. InChIKey: KPPADAGTNGHGBR-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | N-phenylimidazole-1-carboxamide |
| InChIKey | KPPADAGTNGHGBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)