Products 33884-29-6
CAS 33884-29-6 appears in our catalog under these names: 5,5-Dimethyl-2-nitromethyl-1,3-dioxane, ISO 17034 RM, 5,5-dimethyl-2-nitromethyl-1,3-dioxane F. Offered by: HPC Standards, Sigma-Aldrich. Available pack sizes: 100mg, -.
5,5-dimethyl-2-(nitromethyl)-1,3-dioxane (CAS 33884-29-6) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. IUPAC name: 5,5-dimethyl-2-(nitromethyl)-1,3-dioxane. InChIKey: AVQLWXDZRAOBJX-UHFFFAOYSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 5,5-dimethyl-2-(nitromethyl)-1,3-dioxane |
| InChIKey | AVQLWXDZRAOBJX-UHFFFAOYSA-N |
| SMILES | CC1(COC(OC1)C[N+](=O)[O-])C |
Computed by PubChem (NCBI)