CAS 33900-28-6 appears in our catalog under these names: Boc–Trp–OMe, Boc-L-Trp-OMe, Boc-Trp-OMe 98%, N-[(1,1-Dimethylethoxy)carbonyl]-L-tryptophan methyl ester, 98%, 98%, Boc-Trp-OMe, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 500g, 1000g, 250g.
Methyl (2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 33900-28-6) is a chemical compound with the molecular formula C17H22N2O4 and a molecular weight of 318.4 g/mol. IUPAC name: methyl (2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: QXLOVPXUZAOKBL-AWEZNQCLSA-N.
| Molecular formula | C17H22N2O4 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | methyl (2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | QXLOVPXUZAOKBL-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)OC |
Computed by PubChem (NCBI)