Products 339009-43-7
CAS 339009-43-7 is the registry number for (2Z)-3-(4-Chlorophenyl)-2-(1-methyl-1H-pyrrol-2-yl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 1000mg.
(Z)-3-(4-chlorophenyl)-2-(1-methylpyrrol-2-yl)prop-2-enenitrile (CAS 339009-43-7) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: (Z)-3-(4-chlorophenyl)-2-(1-methylpyrrol-2-yl)prop-2-enenitrile. InChIKey: GLUDENDHWQXLKU-FMIVXFBMSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | (Z)-3-(4-chlorophenyl)-2-(1-methylpyrrol-2-yl)prop-2-enenitrile |
| InChIKey | GLUDENDHWQXLKU-FMIVXFBMSA-N |
| SMILES | CN1C=CC=C1/C(=C/C2=CC=C(C=C2)Cl)/C#N |
Computed by PubChem (NCBI)