CAS 339106-98-8 is the registry number for 3-Hydroxypyrido[1,2-a]indole-10-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-hydroxypyrido[1,2-a]indole-10-carbonitrile (CAS 339106-98-8) is a chemical compound with the molecular formula C13H8N2O and a molecular weight of 208.21 g/mol. IUPAC name: 3-hydroxypyrido[1,2-a]indole-10-carbonitrile. InChIKey: OPRUTASSYAGEDI-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3-hydroxypyrido[1,2-a]indole-10-carbonitrile |
| InChIKey | OPRUTASSYAGEDI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(N2C=C1)C=C(C=C3)O)C#N |
Computed by PubChem (NCBI)