CAS 507484-61-9 is the registry number for 2-(6-Methyl-3-oxo-2,3-dihydro-1H-inden-1-ylidene)malononitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-methyl-3-oxoinden-1-ylidene)propanedinitrile (CAS 507484-61-9) is a chemical compound with the molecular formula C13H8N2O and a molecular weight of 208.21 g/mol. IUPAC name: 2-(6-methyl-3-oxoinden-1-ylidene)propanedinitrile. InChIKey: NXFDCVXZHNVIRH-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 2-(6-methyl-3-oxoinden-1-ylidene)propanedinitrile |
| InChIKey | NXFDCVXZHNVIRH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)CC2=C(C#N)C#N |
Computed by PubChem (NCBI)