CAS 3393-00-8 appears in our catalog under these names: (4'-Bromo-[1,1'-biphenyl]-4-yl)(methyl)sulfane, 95+%, 95+%, 4-Bromo-4'-(methylthio)biphenyl, 95+%, (4'-Bromo-[1,1'-biphenyl]-4-yl)(methyl)sulfane, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-bromo-4-(4-methylsulfanylphenyl)benzene (CAS 3393-00-8) is a chemical compound with the molecular formula C13H11BrS and a molecular weight of 279.20 g/mol. IUPAC name: 1-bromo-4-(4-methylsulfanylphenyl)benzene. InChIKey: JUDYTMYLNUSWQC-UHFFFAOYSA-N.
| Molecular formula | C13H11BrS |
|---|---|
| Molecular weight | 279.20 g/mol |
| IUPAC name | 1-bromo-4-(4-methylsulfanylphenyl)benzene |
| InChIKey | JUDYTMYLNUSWQC-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)