CAS 75954-35-7 appears in our catalog under these names: 1-Bromo-4-(phenylsulfanylmethyl)benzene, 95%, (4-Bromobenzyl)(phenyl)sulfane, 97%, (4–Bromobenzyl)(phenyl)sulfane. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-bromo-4-(phenylsulfanylmethyl)benzene (CAS 75954-35-7) is a chemical compound with the molecular formula C13H11BrS and a molecular weight of 279.20 g/mol. IUPAC name: 1-bromo-4-(phenylsulfanylmethyl)benzene. InChIKey: UREFTBXLBXYWNO-UHFFFAOYSA-N.
| Molecular formula | C13H11BrS |
|---|---|
| Molecular weight | 279.20 g/mol |
| IUPAC name | 1-bromo-4-(phenylsulfanylmethyl)benzene |
| InChIKey | UREFTBXLBXYWNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SCC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)