CAS 33948-20-8 appears in our catalog under these names: Oxcarbazepine Impurity 6, Carbamazepine Impurity 9, 10-Bromo-10,11-dihydro-5H-dibenz(b,f)azepine-5-carbonyl Chloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
5-bromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride (CAS 33948-20-8) is a chemical compound with the molecular formula C15H11BrClNO and a molecular weight of 336.61 g/mol. IUPAC name: 5-bromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride. InChIKey: VHLSEKYKAQICDS-UHFFFAOYSA-N.
| Molecular formula | C15H11BrClNO |
|---|---|
| Molecular weight | 336.61 g/mol |
| IUPAC name | 5-bromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride |
| InChIKey | VHLSEKYKAQICDS-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2N(C3=CC=CC=C31)C(=O)Cl)Br |
Computed by PubChem (NCBI)