CAS 892722-20-2 is the registry number for N-(4-Bromo-2-chlorophenyl)-3-phenylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
(E)-N-(4-bromo-2-chlorophenyl)-3-phenylprop-2-enamide (CAS 892722-20-2) is a chemical compound with the molecular formula C15H11BrClNO and a molecular weight of 336.61 g/mol. IUPAC name: (E)-N-(4-bromo-2-chlorophenyl)-3-phenylprop-2-enamide. InChIKey: IYUYUJZWVQHSGC-RMKNXTFCSA-N.
| Molecular formula | C15H11BrClNO |
|---|---|
| Molecular weight | 336.61 g/mol |
| IUPAC name | (E)-N-(4-bromo-2-chlorophenyl)-3-phenylprop-2-enamide |
| InChIKey | IYUYUJZWVQHSGC-RMKNXTFCSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)