CAS 339539-82-1 is the registry number for (R)-tert-Butyl 3-benzyl-3-(1,2,2-trimethylhydrazinecarbonyl)piperidine-1-carboxylate, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Tert-butyl (3R)-3-benzyl-3-[dimethylamino(methyl)carbamoyl]piperidine-1-carboxylate (CAS 339539-82-1) is a chemical compound with the molecular formula C21H33N3O3 and a molecular weight of 375.5 g/mol. IUPAC name: tert-butyl (3R)-3-benzyl-3-[dimethylamino(methyl)carbamoyl]piperidine-1-carboxylate. InChIKey: MICNJOWZWSCGOQ-OAQYLSRUSA-N.
| Molecular formula | C21H33N3O3 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | tert-butyl (3R)-3-benzyl-3-[dimethylamino(methyl)carbamoyl]piperidine-1-carboxylate |
| InChIKey | MICNJOWZWSCGOQ-OAQYLSRUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@](C1)(CC2=CC=CC=C2)C(=O)N(C)N(C)C |
Computed by PubChem (NCBI)