CAS 745070-61-5 is the registry number for 1,3,5-Tris(2,2-dimethylpropanamido)benzene. Offered by: HPC Standards. Available pack sizes: 1x100mg.
N-[3,5-bis(2,2-dimethylpropanoylamino)phenyl]-2,2-dimethylpropanamide (CAS 745070-61-5) is a chemical compound with the molecular formula C21H33N3O3 and a molecular weight of 375.5 g/mol. IUPAC name: N-[3,5-bis(2,2-dimethylpropanoylamino)phenyl]-2,2-dimethylpropanamide. InChIKey: CPEULHAPWXMDDV-UHFFFAOYSA-N.
| Molecular formula | C21H33N3O3 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | N-[3,5-bis(2,2-dimethylpropanoylamino)phenyl]-2,2-dimethylpropanamide |
| InChIKey | CPEULHAPWXMDDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=CC(=C1)NC(=O)C(C)(C)C)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)