Products 3396-71-2
CAS 3396-71-2 is the registry number for 3-Deoxy-1,2-O-isopropylidene-α-D-ribofuranose. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol (CAS 3396-71-2) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: [(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol. InChIKey: CGUKUJDDXZARJQ-RRKCRQDMSA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 174.19 g/mol |
| IUPAC name | [(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol |
| InChIKey | CGUKUJDDXZARJQ-RRKCRQDMSA-N |
| SMILES | CC1(O[C@@H]2C[C@H](O[C@@H]2O1)CO)C |
Computed by PubChem (NCBI)