Products 33964-75-9

CAS 33964-75-9 appears in our catalog under these names: 13(S)-HpODE, 13(S)–HpODE, 13(S)-HPODE, 95.05%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 50ug, 100ug, 500ug, 100μg, 50μg, 500μg, 100 μg (320.06 μM * 1 mL in Ethanol).

Structural formula: {0} (CAS {1})

(9Z,11E,13S)-13-hydroperoxyoctadeca-9,11-dienoic acid (CAS 33964-75-9) is a chemical compound with the molecular formula C18H32O4 and a molecular weight of 312.4 g/mol. IUPAC name: (9Z,11E,13S)-13-hydroperoxyoctadeca-9,11-dienoic acid. InChIKey: JDSRHVWSAMTSSN-IRQZEAMPSA-N.

Identity
Molecular formulaC18H32O4
Molecular weight312.4 g/mol
IUPAC name(9Z,11E,13S)-13-hydroperoxyoctadeca-9,11-dienoic acid
InChIKeyJDSRHVWSAMTSSN-IRQZEAMPSA-N
SMILESCCCCC[C@@H](/C=C/C=C\CCCCCCCC(=O)O)OO

Computed by PubChem (NCBI)