Products 4494-16-0
CAS 4494-16-0 appears in our catalog under these names: Octadec-9-enedioic Acid, Octadec–9–enedioic acid, Octadec-9-enedioic acid, 98%, 98%, Octadec-9-enedioic acid, 98%, Octadec-9-enedioic acid, 75%. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 500mg, 10mg, 250mg, 50mg, 25mg, 100mg, 1g.
Octadec-9-enedioic acid (CAS 4494-16-0) is a chemical compound with the molecular formula C18H32O4 and a molecular weight of 312.4 g/mol. IUPAC name: octadec-9-enedioic acid. InChIKey: SBLKVIQSIHEQOF-UHFFFAOYSA-N.
| Molecular formula | C18H32O4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | octadec-9-enedioic acid |
| InChIKey | SBLKVIQSIHEQOF-UHFFFAOYSA-N |
| SMILES | C(CCCC=CCCCCCCCC(=O)O)CCCC(=O)O |
Computed by PubChem (NCBI)