CAS 3397-29-3 appears in our catalog under these names: Pht-gly-osu, 95%, 2,5-Dioxopyrrolidin-1-yl 2-(1,3-dioxoisoindolin-2-yl)acetate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2,5-dioxopyrrolidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)acetate (CAS 3397-29-3) is a chemical compound with the molecular formula C14H10N2O6 and a molecular weight of 302.24 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)acetate. InChIKey: NQZZTHXHURDXOR-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O6 |
|---|---|
| Molecular weight | 302.24 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)acetate |
| InChIKey | NQZZTHXHURDXOR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)