CAS 6370-88-3 is the registry number for 4,8-Diamino-1,2,5,6-tetrahydroxyanthracene-9,10-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,8-diamino-1,2,5,6-tetrahydroxyanthracene-9,10-dione (CAS 6370-88-3) is a chemical compound with the molecular formula C14H10N2O6 and a molecular weight of 302.24 g/mol. IUPAC name: 4,8-diamino-1,2,5,6-tetrahydroxyanthracene-9,10-dione. InChIKey: XBVUXRZERLDXMU-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O6 |
|---|---|
| Molecular weight | 302.24 g/mol |
| IUPAC name | 4,8-diamino-1,2,5,6-tetrahydroxyanthracene-9,10-dione |
| InChIKey | XBVUXRZERLDXMU-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1O)O)C(=O)C3=C(C2=O)C(=C(C=C3N)O)O)N |
Computed by PubChem (NCBI)