Products 340217-69-8
CAS 340217-69-8 is the registry number for 3-(2,6-dichlorophenyl)-2-(phenylcarbonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-2-benzoyl-3-(2,6-dichlorophenyl)prop-2-enenitrile (CAS 340217-69-8) is a chemical compound with the molecular formula C16H9Cl2NO and a molecular weight of 302.2 g/mol. IUPAC name: (E)-2-benzoyl-3-(2,6-dichlorophenyl)prop-2-enenitrile. InChIKey: WABIGNJSAFBSDL-FMIVXFBMSA-N.
| Molecular formula | C16H9Cl2NO |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | (E)-2-benzoyl-3-(2,6-dichlorophenyl)prop-2-enenitrile |
| InChIKey | WABIGNJSAFBSDL-FMIVXFBMSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C(=C/C2=C(C=CC=C2Cl)Cl)/C#N |
Computed by PubChem (NCBI)