Products 883526-41-8
CAS 883526-41-8 appears in our catalog under these names: 2-(3-Chlorophenyl)quinoline-4-carbonyl chloride, 95%, 2-(3-Chlorophenyl)quinoline-4-carbonyl chloride, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-(3-chlorophenyl)quinoline-4-carbonyl chloride (CAS 883526-41-8) is a chemical compound with the molecular formula C16H9Cl2NO and a molecular weight of 302.2 g/mol. IUPAC name: 2-(3-chlorophenyl)quinoline-4-carbonyl chloride. InChIKey: FLOLXQYLMQKHTR-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl2NO |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 2-(3-chlorophenyl)quinoline-4-carbonyl chloride |
| InChIKey | FLOLXQYLMQKHTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC(=CC=C3)Cl)C(=O)Cl |
Computed by PubChem (NCBI)