CAS 340301-17-9 is the registry number for 1-(2,3-dichlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(2,3-dichlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 340301-17-9) is a chemical compound with the molecular formula C10H6Cl2N2O2S and a molecular weight of 289.14 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: IRBBGYUPHOZQPR-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2S |
|---|---|
| Molecular weight | 289.14 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | IRBBGYUPHOZQPR-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=S)N(C1=O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)