CAS 728918-54-5 appears in our catalog under these names: 2-((2,4-Dichlorophenyl)amino)thiazole-4-carboxylic acid, 97%, 2-((2,4-Dichlorophenyl)amino)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 1000mg.
2-(2,4-dichloroanilino)-1,3-thiazole-4-carboxylic acid (CAS 728918-54-5) is a chemical compound with the molecular formula C10H6Cl2N2O2S and a molecular weight of 289.14 g/mol. IUPAC name: 2-(2,4-dichloroanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: VNHCBUKRBYDTBA-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2S |
|---|---|
| Molecular weight | 289.14 g/mol |
| IUPAC name | 2-(2,4-dichloroanilino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | VNHCBUKRBYDTBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)