CAS 340702-10-5 appears in our catalog under these names: 6–Fluoroisoindolin–1–one, 6-Fluoroisoindolin-1-one 95%, 1H-Isoindol-1-one, 6-fluoro-2,3-dihydro-, 98%, 98%, 6-Fluoroisoindolin-1-one, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 25g.
6-fluoro-2,3-dihydroisoindol-1-one (CAS 340702-10-5) is a chemical compound with the molecular formula C8H6FNO and a molecular weight of 151.14 g/mol. IUPAC name: 6-fluoro-2,3-dihydroisoindol-1-one. InChIKey: TWGFYAUQRMVTSI-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO |
|---|---|
| Molecular weight | 151.14 g/mol |
| IUPAC name | 6-fluoro-2,3-dihydroisoindol-1-one |
| InChIKey | TWGFYAUQRMVTSI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)F)C(=O)N1 |
Computed by PubChem (NCBI)