CAS 3408-13-7 is the registry number for 2,2'-Bis(p-naphthoquinone). Offered by: TRC. Available pack sizes: 100mg.
2-(1,4-dioxonaphthalen-2-yl)naphthalene-1,4-dione (CAS 3408-13-7) is a chemical compound with the molecular formula C20H10O4 and a molecular weight of 314.3 g/mol. IUPAC name: 2-(1,4-dioxonaphthalen-2-yl)naphthalene-1,4-dione. InChIKey: QWYZAMKNTSAAPN-UHFFFAOYSA-N.
| Molecular formula | C20H10O4 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 2-(1,4-dioxonaphthalen-2-yl)naphthalene-1,4-dione |
| InChIKey | QWYZAMKNTSAAPN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(C2=O)C3=CC(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)