CAS 64517-67-5 is the registry number for 4,4'-Bi(1,2-naphthoquinone). Offered by: TRC. Available pack sizes: 100mg.
4-(3,4-dioxonaphthalen-1-yl)naphthalene-1,2-dione (CAS 64517-67-5) is a chemical compound with the molecular formula C20H10O4 and a molecular weight of 314.3 g/mol. IUPAC name: 4-(3,4-dioxonaphthalen-1-yl)naphthalene-1,2-dione. InChIKey: STWDPXLKJOBSQW-UHFFFAOYSA-N.
| Molecular formula | C20H10O4 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 4-(3,4-dioxonaphthalen-1-yl)naphthalene-1,2-dione |
| InChIKey | STWDPXLKJOBSQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)C2=O)C3=CC(=O)C(=O)C4=CC=CC=C43 |
Computed by PubChem (NCBI)