Products 340967-98-8
CAS 340967-98-8 is the registry number for 6-Nitro-3-(pyrrolidin-1-ylmethyl)-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
6-nitro-3-(pyrrolidin-1-ylmethyl)-1H-indole (CAS 340967-98-8) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: 6-nitro-3-(pyrrolidin-1-ylmethyl)-1H-indole. InChIKey: YDTIVJACAUPSQZ-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 6-nitro-3-(pyrrolidin-1-ylmethyl)-1H-indole |
| InChIKey | YDTIVJACAUPSQZ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=CNC3=C2C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)