CAS 34122-28-6 appears in our catalog under these names: 4-(3-Phenylpropyl)pyridine n-oxide, 95%, 3-(3-Phenylpropyl)pyridine 1-oxide, 97%, 4-(3-Phenylpropyl)pyridine N-oxide, 97%, 97%. Offered by: Combi-blocks, AmBeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 100g, 100mg, 250mg, 1g, 10g, 25g.
1-oxido-4-(3-phenylpropyl)pyridin-1-ium (CAS 34122-28-6) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 1-oxido-4-(3-phenylpropyl)pyridin-1-ium. InChIKey: OOFBEJNEUVLZOW-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 1-oxido-4-(3-phenylpropyl)pyridin-1-ium |
| InChIKey | OOFBEJNEUVLZOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC2=CC=[N+](C=C2)[O-] |
Computed by PubChem (NCBI)