CAS 84824-92-0 is the registry number for 4-(3-Phenyl-propyl)-pyridine 1-oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1-oxido-4-(3-phenylpropyl)pyridin-1-ium (CAS 84824-92-0) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 1-oxido-4-(3-phenylpropyl)pyridin-1-ium. InChIKey: OOFBEJNEUVLZOW-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 1-oxido-4-(3-phenylpropyl)pyridin-1-ium |
| InChIKey | OOFBEJNEUVLZOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC2=CC=[N+](C=C2)[O-] |
Computed by PubChem (NCBI)