CAS 3414-34-4 appears in our catalog under these names: Etiroxate Carboxylic Acid, >95% (HPLC), Etiroxate carboxylic acid. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid (CAS 3414-34-4) is a chemical compound with the molecular formula C16H13I4NO4 and a molecular weight of 790.90 g/mol. IUPAC name: 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid. InChIKey: XVWORJPLTFZBFO-UHFFFAOYSA-N.
| Molecular formula | C16H13I4NO4 |
|---|---|
| Molecular weight | 790.90 g/mol |
| IUPAC name | 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid |
| InChIKey | XVWORJPLTFZBFO-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C(=C1)I)OC2=CC(=C(C(=C2)I)O)I)I)(C(=O)O)N |
Computed by PubChem (NCBI)