CAS 4367-89-9 appears in our catalog under these names: Levothyroxine Impurity 33, O-Methylthyroxine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg.
(2S)-2-amino-3-[4-(3,5-diiodo-4-methoxyphenoxy)-3,5-diiodophenyl]propanoic acid (CAS 4367-89-9) is a chemical compound with the molecular formula C16H13I4NO4 and a molecular weight of 790.90 g/mol. IUPAC name: (2S)-2-amino-3-[4-(3,5-diiodo-4-methoxyphenoxy)-3,5-diiodophenyl]propanoic acid. InChIKey: CTRBRDHEPJCPON-ZDUSSCGKSA-N.
| Molecular formula | C16H13I4NO4 |
|---|---|
| Molecular weight | 790.90 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(3,5-diiodo-4-methoxyphenoxy)-3,5-diiodophenyl]propanoic acid |
| InChIKey | CTRBRDHEPJCPON-ZDUSSCGKSA-N |
| SMILES | COC1=C(C=C(C=C1I)OC2=C(C=C(C=C2I)C[C@@H](C(=O)O)N)I)I |
Computed by PubChem (NCBI)