CAS 3419-00-9 appears in our catalog under these names: 2-Phenyl-1H-indol-5-ol, 98%, 98%, 2-Phenyl-1H-indol-5-ol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-phenyl-1H-indol-5-ol (CAS 3419-00-9) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 209.24 g/mol. IUPAC name: 2-phenyl-1H-indol-5-ol. InChIKey: RAEPNARTKQGOEP-UHFFFAOYSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 2-phenyl-1H-indol-5-ol |
| InChIKey | RAEPNARTKQGOEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(N2)C=CC(=C3)O |
Computed by PubChem (NCBI)