CAS 341942-07-2 is the registry number for 4-Methoxy-3-((4-nitrophenyl)methoxy)benzaldehyde. Offered by: Biosynth. Available pack sizes: 2,5g.
4-methoxy-3-[(4-nitrophenyl)methoxy]benzaldehyde (CAS 341942-07-2) is a chemical compound with the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. IUPAC name: 4-methoxy-3-[(4-nitrophenyl)methoxy]benzaldehyde. InChIKey: XFOHQGZIGRZTDA-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 4-methoxy-3-[(4-nitrophenyl)methoxy]benzaldehyde |
| InChIKey | XFOHQGZIGRZTDA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=O)OCC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)