Products 34221-61-9
CAS 34221-61-9 appears in our catalog under these names: (9H–Fluoren–9–yl)methanamine hydrochloride, (9H-Fluoren-9-yl)methanamine hydrochloride 96%, (9H-Fluoren-9-yl)methanamine hydrochloride, 98%, (9H-Fluoren-9-yl)methanamine hydrochloride, 96%, 96%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
9H-fluoren-9-ylmethanamine;hydrochloride (CAS 34221-61-9) is a chemical compound with the molecular formula C14H14ClN and a molecular weight of 231.72 g/mol. IUPAC name: 9H-fluoren-9-ylmethanamine;hydrochloride. InChIKey: GISJMTUTYQLZHT-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethanamine;hydrochloride |
| InChIKey | GISJMTUTYQLZHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)CN.Cl |
Computed by PubChem (NCBI)