CAS 342373-23-3 is the registry number for Oxamflatin Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Ethyl (E)-5-[3-(benzenesulfonamido)phenyl]pent-2-en-4-ynoate (CAS 342373-23-3) is a chemical compound with the molecular formula C19H17NO4S and a molecular weight of 355.4 g/mol. IUPAC name: ethyl (E)-5-[3-(benzenesulfonamido)phenyl]pent-2-en-4-ynoate. InChIKey: UZUNLIWBSHTVDE-VGOFMYFVSA-N.
| Molecular formula | C19H17NO4S |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | ethyl (E)-5-[3-(benzenesulfonamido)phenyl]pent-2-en-4-ynoate |
| InChIKey | UZUNLIWBSHTVDE-VGOFMYFVSA-N |
| SMILES | CCOC(=O)/C=C/C#CC1=CC(=CC=C1)NS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)