Products 603952-63-2
CAS 603952-63-2 is the registry number for Tazarotenic acid sulfone. Offered by: Biosynth. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg.
6-[2-(4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylic acid (CAS 603952-63-2) is a chemical compound with the molecular formula C19H17NO4S and a molecular weight of 355.4 g/mol. IUPAC name: 6-[2-(4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylic acid. InChIKey: SNSJBSLKHBITIU-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4S |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 6-[2-(4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylic acid |
| InChIKey | SNSJBSLKHBITIU-UHFFFAOYSA-N |
| SMILES | CC1(CCS(=O)(=O)C2=C1C=C(C=C2)C#CC3=NC=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)