CAS 342379-28-6 is the registry number for 2-(4-(tert-Butyl)benzamido)-4-(4-methoxyphenyl)thiophene-3-carboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-[(4-tert-butylbenzoyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylic acid (CAS 342379-28-6) is a chemical compound with the molecular formula C23H23NO4S and a molecular weight of 409.5 g/mol. IUPAC name: 2-[(4-tert-butylbenzoyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylic acid. InChIKey: ZZJMGALGEWSUIJ-UHFFFAOYSA-N.
| Molecular formula | C23H23NO4S |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | 2-[(4-tert-butylbenzoyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylic acid |
| InChIKey | ZZJMGALGEWSUIJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)NC2=C(C(=CS2)C3=CC=C(C=C3)OC)C(=O)O |
Computed by PubChem (NCBI)