CAS 793690-05-8 appears in our catalog under these names: 5-((3,3-Diphenylpropyl)sulfamoyl)-2-methylbenzoic acid, 95%, 5-((3,3-Diphenylpropyl)sulfamoyl)-2-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-(3,3-diphenylpropylsulfamoyl)-2-methylbenzoic acid (CAS 793690-05-8) is a chemical compound with the molecular formula C23H23NO4S and a molecular weight of 409.5 g/mol. IUPAC name: 5-(3,3-diphenylpropylsulfamoyl)-2-methylbenzoic acid. InChIKey: XMLWZCBHDDZTKZ-UHFFFAOYSA-N.
| Molecular formula | C23H23NO4S |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | 5-(3,3-diphenylpropylsulfamoyl)-2-methylbenzoic acid |
| InChIKey | XMLWZCBHDDZTKZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NCCC(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)