CAS 342405-28-1 is the registry number for 1-(Phenylsulfonyl)-1h-indole-2-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
1-(benzenesulfonyl)indole-2-carbonyl chloride (CAS 342405-28-1) is a chemical compound with the molecular formula C15H10ClNO3S and a molecular weight of 319.8 g/mol. IUPAC name: 1-(benzenesulfonyl)indole-2-carbonyl chloride. InChIKey: MDDUSWMIZCDHNC-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO3S |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | 1-(benzenesulfonyl)indole-2-carbonyl chloride |
| InChIKey | MDDUSWMIZCDHNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C3=CC=CC=C3C=C2C(=O)Cl |
Computed by PubChem (NCBI)