CAS 5409-91-6 is the registry number for 4-Chlorophenyl quinoline-8-sulfonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorophenyl) quinoline-8-sulfonate (CAS 5409-91-6) is a chemical compound with the molecular formula C15H10ClNO3S and a molecular weight of 319.8 g/mol. IUPAC name: (4-chlorophenyl) quinoline-8-sulfonate. InChIKey: WPVTYQWOFPYPSA-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO3S |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | (4-chlorophenyl) quinoline-8-sulfonate |
| InChIKey | WPVTYQWOFPYPSA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)OC3=CC=C(C=C3)Cl)N=CC=C2 |
Computed by PubChem (NCBI)