Products 34258-14-5
CAS 34258-14-5 appears in our catalog under these names: H–Gly–D–Phe–OH, Glycyl-D-phenylalanine, >95% (HPLC), H-Gly-D-Phe-OH, H-Gly-D-Phe-OH, 97%, 97%, Gly-d-Phe, 99.44%. Offered by: GLPBio, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5g, 100mg, 25mg, 50mg, 25g, 0,5g, 250mg, 1g.
(2R)-2-[(2-aminoacetyl)amino]-3-phenylpropanoic acid (CAS 34258-14-5) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: (2R)-2-[(2-aminoacetyl)amino]-3-phenylpropanoic acid. InChIKey: JBCLFWXMTIKCCB-SECBINFHSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (2R)-2-[(2-aminoacetyl)amino]-3-phenylpropanoic acid |
| InChIKey | JBCLFWXMTIKCCB-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)CN |
Computed by PubChem (NCBI)
Synonyms:
GLYCYL-D-PHENYLALANINE, gly-D-phenylalanine, glycylphenylalanine, (D)-, H-GLY-D-PHE-OH, Gly-D-Phe, (2R)-2-[(2-aminoacetyl)amino]-3-phenylpropanoic acid, (R)-2-(2-Aminoacetylamino)-3-phenylpropionic acid, Alanine, N-glycyl-3-phenyl-, D-, (R)-2-(2-Aminoacetamido)-3-phenylPropanoic acid, (2R)-2-[(2-aminoacetyl)amino]-3-phenyl-propanoic acid