CAS 34261-55-7 is the registry number for 2,2'-Dihydroxy-5,5'-dibromobiphenyl. Offered by: TRC. Available pack sizes: 100mg.
4-bromo-2-(5-bromo-2-hydroxyphenyl)phenol (CAS 34261-55-7) is a chemical compound with the molecular formula C12H8Br2O2 and a molecular weight of 344.00 g/mol. IUPAC name: 4-bromo-2-(5-bromo-2-hydroxyphenyl)phenol. InChIKey: FCTQSFVLYRQKTR-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2O2 |
|---|---|
| Molecular weight | 344.00 g/mol |
| IUPAC name | 4-bromo-2-(5-bromo-2-hydroxyphenyl)phenol |
| InChIKey | FCTQSFVLYRQKTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C2=C(C=CC(=C2)Br)O)O |
Computed by PubChem (NCBI)