CAS 880872-48-0 is the registry number for 4-bromo-2-(4-bromophenoxy)-Phenol. Offered by: TRC. Available pack sizes: 100mg.
4-bromo-2-(4-bromophenoxy)phenol (CAS 880872-48-0) is a chemical compound with the molecular formula C12H8Br2O2 and a molecular weight of 344.00 g/mol. IUPAC name: 4-bromo-2-(4-bromophenoxy)phenol. InChIKey: GADOGJSKUPYKLP-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2O2 |
|---|---|
| Molecular weight | 344.00 g/mol |
| IUPAC name | 4-bromo-2-(4-bromophenoxy)phenol |
| InChIKey | GADOGJSKUPYKLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=CC(=C2)Br)O)Br |
Computed by PubChem (NCBI)