CAS 34271-32-4 is the registry number for rac-(1R,2S)-1-Methyl-2-phenylcyclopropane-1-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1S,2R)-1-methyl-2-phenylcyclopropane-1-carbaldehyde (CAS 34271-32-4) is a chemical compound with the molecular formula C11H12O and a molecular weight of 160.21 g/mol. IUPAC name: cis-(1S,2R)-1-methyl-2-phenylcyclopropane-1-carbaldehyde. InChIKey: PHEQDTOMKNXMHJ-GHMZBOCLSA-N.
| Molecular formula | C11H12O |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | cis-(1S,2R)-1-methyl-2-phenylcyclopropane-1-carbaldehyde |
| InChIKey | PHEQDTOMKNXMHJ-GHMZBOCLSA-N |
| SMILES | C[C@@]1(C[C@@H]1C2=CC=CC=C2)C=O |
Computed by PubChem (NCBI)