Products 342821-66-3
CAS 342821-66-3 appears in our catalog under these names: 4-Acetamido Antipyrine-d3, >95% (HPLC), 4–Acetamido Antipyrine–d3, 4-Acetylaminoantipyrine-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 100mg, 50 mg, 5 mg.
2,2,2-trideuterio-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide (CAS 342821-66-3) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 248.30 g/mol. IUPAC name: 2,2,2-trideuterio-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide. InChIKey: OIAGWXKSCXPNNZ-BMSJAHLVSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide |
| InChIKey | OIAGWXKSCXPNNZ-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC1=C(N(N(C1=O)C2=CC=CC=C2)C)C |
Computed by PubChem (NCBI)