Products 34285-36-4

CAS 34285-36-4 is the registry number for 2-Ethoxycarbonyl-1-methylpyridinium Iodide. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

Ethyl 1-methylpyridin-1-ium-2-carboxylate iodide (CAS 34285-36-4) is a chemical compound with the molecular formula C9H12INO2 and a molecular weight of 293.10 g/mol. IUPAC name: ethyl 1-methylpyridin-1-ium-2-carboxylate iodide. InChIKey: KFQACWOGZLKWSA-UHFFFAOYSA-M.

Identity
Molecular formulaC9H12INO2
Molecular weight293.10 g/mol
IUPAC nameethyl 1-methylpyridin-1-ium-2-carboxylate iodide
InChIKeyKFQACWOGZLKWSA-UHFFFAOYSA-M
SMILESCCOC(=O)C1=CC=CC=[N+]1C.[I-]

Computed by PubChem (NCBI)