CAS 34285-36-4 is the registry number for 2-Ethoxycarbonyl-1-methylpyridinium Iodide. Offered by: TRC. Available pack sizes: 500mg.
Ethyl 1-methylpyridin-1-ium-2-carboxylate iodide (CAS 34285-36-4) is a chemical compound with the molecular formula C9H12INO2 and a molecular weight of 293.10 g/mol. IUPAC name: ethyl 1-methylpyridin-1-ium-2-carboxylate iodide. InChIKey: KFQACWOGZLKWSA-UHFFFAOYSA-M.
| Molecular formula | C9H12INO2 |
|---|---|
| Molecular weight | 293.10 g/mol |
| IUPAC name | ethyl 1-methylpyridin-1-ium-2-carboxylate iodide |
| InChIKey | KFQACWOGZLKWSA-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=CC=CC=[N+]1C.[I-] |
Computed by PubChem (NCBI)